C16H15N5O6S2 — CID 136795257
2-[[5-amino-3-methyl-1-(3-sulfophenyl)pyrazol-4-yl]diazenyl]benzenesulfonic acid (PubChem CID 136795257) has the molecular formula C16H15N5O6S2 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-[[5-amino-3-methyl-1-(3-sulfophenyl)pyrazol-4-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[5-amino-3-methyl-1-(3-sulfophenyl)pyrazol-4-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136795257 |
| Molecular Formula | C16H15N5O6S2 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-[[5-amino-3-methyl-1-(3-sulfophenyl)pyrazol-4-yl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1nn(-c2cccc(S(=O)(=O)O)c2)c(N)c1/N=N/c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C16H15N5O6S2/c1-10-15(19-18-13-7-2-3-8-14(13)29(25,26)27)16(17)21(20-10)11-5-4-6-12(9-11)28(22,23)24/h2-9H,17H2,1H3,(H,22,23,24)(H,25,26,27)/b19-18+ |
| InChIKey | QDGCMDCPEMMKPH-VHEBQXMUSA-N |
| XLogP | 2.67 |
| TPSA | 177.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|