C17H14N6O6S3 — CID 136593881
2-[[5-amino-3-methyl-1-(4-sulfophenyl)pyrazol-4-yl]diazenyl]-1,3-benzothiazole-5-sulfonic acid (PubChem CID 136593881) has the molecular formula C17H14N6O6S3 and a molecular weight of 494.54 g/mol. Its IUPAC name is 2-[[5-amino-3-methyl-1-(4-sulfophenyl)pyrazol-4-yl]diazenyl]-1,3-benzothiazole-5-sulfonic acid.
| Compound Name | 2-[[5-amino-3-methyl-1-(4-sulfophenyl)pyrazol-4-yl]diazenyl]-1,3-benzothiazole-5-sulfonic acid |
|---|---|
| PubChem CID | 136593881 |
| Molecular Formula | C17H14N6O6S3 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 2-[[5-amino-3-methyl-1-(4-sulfophenyl)pyrazol-4-yl]diazenyl]-1,3-benzothiazole-5-sulfonic acid |
| SMILES | Cc1nn(-c2ccc(S(=O)(=O)O)cc2)c(N)c1/N=N/c1nc2cc(S(=O)(=O)O)ccc2s1 |
| InChI | InChI=1S/C17H14N6O6S3/c1-9-15(16(18)23(22-9)10-2-4-11(5-3-10)31(24,25)26)20-21-17-19-13-8-12(32(27,28)29)6-7-14(13)30-17/h2-8H,18H2,1H3,(H,24,25,26)(H,27,28,29)/b21-20+ |
| InChIKey | PTTXQUXZNFEPQJ-QZQOTICOSA-N |
| XLogP | 3.28 |
| TPSA | 190.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|