C14H14N4O3S — CID 142894207
7-(4,5-diamino-3-methylpyrazol-1-yl)naphthalene-2-sulfonic acid (PubChem CID 142894207) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is 7-(4,5-diamino-3-methylpyrazol-1-yl)naphthalene-2-sulfonic acid.
| Compound Name | 7-(4,5-diamino-3-methylpyrazol-1-yl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 142894207 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 7-(4,5-diamino-3-methylpyrazol-1-yl)naphthalene-2-sulfonic acid |
| SMILES | Cc1nn(-c2ccc3ccc(S(=O)(=O)O)cc3c2)c(N)c1N |
| InChI | InChI=1S/C14H14N4O3S/c1-8-13(15)14(16)18(17-8)11-4-2-9-3-5-12(22(19,20)21)7-10(9)6-11/h2-7H,15-16H2,1H3,(H,19,20,21) |
| InChIKey | JIHQCSXVVZOYMW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|