C11H15N5O3S — CID 142894230
2-amino-5-[5-amino-3-methyl-4-(methylamino)pyrazol-1-yl]benzenesulfonic acid (PubChem CID 142894230) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-amino-5-[5-amino-3-methyl-4-(methylamino)pyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 2-amino-5-[5-amino-3-methyl-4-(methylamino)pyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 142894230 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-amino-5-[5-amino-3-methyl-4-(methylamino)pyrazol-1-yl]benzenesulfonic acid |
| SMILES | CNc1c(C)nn(-c2ccc(N)c(S(=O)(=O)O)c2)c1N |
| InChI | InChI=1S/C11H15N5O3S/c1-6-10(14-2)11(13)16(15-6)7-3-4-8(12)9(5-7)20(17,18)19/h3-5,14H,12-13H2,1-2H3,(H,17,18,19) |
| InChIKey | MAZUKYOIZBJCDL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|