C21H16N2Na2O7S2 — CID 87937963
CID 87937963 (PubChem CID 87937963) has the molecular formula C21H16N2Na2O7S2 and a molecular weight of 518.48 g/mol.
| Compound Name | CID 87937963 |
|---|---|
| PubChem CID | 87937963 |
| Molecular Formula | C21H16N2Na2O7S2 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc2ccc(S(=O)(=O)O)cc2c1)Nc1ccc2ccc(S(=O)(=O)O)cc2c1.[Na].[Na] |
| InChI | InChI=1S/C21H16N2O7S2.2Na/c24-21(22-17-5-1-13-3-7-19(31(25,26)27)11-15(13)9-17)23-18-6-2-14-4-8-20(32(28,29)30)12-16(14)10-18;;/h1-12H,(H2,22,23,24)(H,25,26,27)(H,28,29,30);; |
| InChIKey | GNFVEZJDZSCECI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|