C25H26N4O5S2 — CID 58665205
1,3-bis[7-(dimethylsulfamoyl)naphthalen-2-yl]urea (PubChem CID 58665205) has the molecular formula C25H26N4O5S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is 1,3-bis[7-(dimethylsulfamoyl)naphthalen-2-yl]urea.
| Compound Name | 1,3-bis[7-(dimethylsulfamoyl)naphthalen-2-yl]urea |
|---|---|
| PubChem CID | 58665205 |
| Molecular Formula | C25H26N4O5S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 1,3-bis[7-(dimethylsulfamoyl)naphthalen-2-yl]urea |
| SMILES | CN(C)S(=O)(=O)c1ccc2ccc(NC(=O)Nc3ccc4ccc(S(=O)(=O)N(C)C)cc4c3)cc2c1 |
| InChI | InChI=1S/C25H26N4O5S2/c1-28(2)35(31,32)23-11-7-17-5-9-21(13-19(17)15-23)26-25(30)27-22-10-6-18-8-12-24(16-20(18)14-22)36(33,34)29(3)4/h5-16H,1-4H3,(H2,26,27,30) |
| InChIKey | WSGUQJGDKQBLHK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |