C13H21N3O4S — CID 146089010
1-[4-(dimethylsulfamoyl)phenyl]-3-(4-hydroxybutan-2-yl)urea (PubChem CID 146089010) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-[4-(dimethylsulfamoyl)phenyl]-3-(4-hydroxybutan-2-yl)urea.
| Compound Name | 1-[4-(dimethylsulfamoyl)phenyl]-3-(4-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 146089010 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[4-(dimethylsulfamoyl)phenyl]-3-(4-hydroxybutan-2-yl)urea |
| SMILES | CC(CCO)NC(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H21N3O4S/c1-10(8-9-17)14-13(18)15-11-4-6-12(7-5-11)21(19,20)16(2)3/h4-7,10,17H,8-9H2,1-3H3,(H2,14,15,18) |
| InChIKey | OQAQPZZCKYAENH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |