C14H21N3O4S — CID 94756092
1-[(2R)-1-hydroxypropan-2-yl]-3-[4-[methyl(prop-2-enyl)sulfamoyl]phenyl]urea (PubChem CID 94756092) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxypropan-2-yl]-3-[4-[methyl(prop-2-enyl)sulfamoyl]phenyl]urea.
| Compound Name | 1-[(2R)-1-hydroxypropan-2-yl]-3-[4-[methyl(prop-2-enyl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 94756092 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[(2R)-1-hydroxypropan-2-yl]-3-[4-[methyl(prop-2-enyl)sulfamoyl]phenyl]urea |
| SMILES | C=CCN(C)S(=O)(=O)c1ccc(NC(=O)N[C@H](C)CO)cc1 |
| InChI | InChI=1S/C14H21N3O4S/c1-4-9-17(3)22(20,21)13-7-5-12(6-8-13)16-14(19)15-11(2)10-18/h4-8,11,18H,1,9-10H2,2-3H3,(H2,15,16,19)/t11-/m1/s1 |
| InChIKey | OLQSPMCSSLNULM-LLVKDONJSA-N |
| XLogP | 1.00 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|