C17H11N3O4S2 — CID 171384167
5-(1,3-benzothiazol-2-yldiazenyl)-6-hydroxynaphthalene-2-sulfonic acid (PubChem CID 171384167) has the molecular formula C17H11N3O4S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yldiazenyl)-6-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 5-(1,3-benzothiazol-2-yldiazenyl)-6-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 171384167 |
| Molecular Formula | C17H11N3O4S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yldiazenyl)-6-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(/N=N/c3nc4ccccc4s3)c(O)ccc2c1 |
| InChI | InChI=1S/C17H11N3O4S2/c21-14-8-5-10-9-11(26(22,23)24)6-7-12(10)16(14)19-20-17-18-13-3-1-2-4-15(13)25-17/h1-9,21H,(H,22,23,24)/b20-19+ |
| InChIKey | PSYYYXJLEUGMEW-FMQUCBEESA-N |
| XLogP | 4.82 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|