About 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron
6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron (PubChem CID 175582411) has the molecular formula C10H7FeNO5S
and a molecular weight of 309.08 g/mol. Its IUPAC name is 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron.
Molecular Properties
| Compound Name | 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron |
| PubChem CID | 175582411 |
| Molecular Formula | C10H7FeNO5S |
| Molecular Weight | 309.08 g/mol |
| Exact Mass | 308.94 |
| IUPAC Name | 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron |
| SMILES | O=Nc1c(O)ccc2cc(S(=O)(=O)O)ccc12.[Fe] |
| InChI | InChI=1S/C10H7NO5S.Fe/c12-9-4-1-6-5-7(17(14,15)16)2-3-8(6)10(9)11-13;/h1-5,12H,(H,14,15,16); |
| InChIKey | NYKYDFGMWHHOBC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.08 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron?
The IUPAC name of 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron (CID 175582411) is 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron.
What is the SMILES notation for 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron?
The canonical SMILES for 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron is O=Nc1c(O)ccc2cc(S(=O)(=O)O)ccc12.[Fe].
What is the InChIKey of 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron?
The InChIKey is NYKYDFGMWHHOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO5S.Fe/c12-9-4-1-6-5-7(17(14,15)16)2-3-8(6)10(9)11-13;/h1-5,12H,(H,14,15,16);.
What are the key properties of 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron?
6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron has a molecular weight of 309.08 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-5-nitrosonaphthalene-2-sulfonic acid;iron is sourced from PubChem (CID 175582411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).