C16H11N3NaO6S — CID 137221760
CID 137221760 (PubChem CID 137221760) has the molecular formula C16H11N3NaO6S and a molecular weight of 396.34 g/mol.
| Compound Name | CID 137221760 |
|---|---|
| PubChem CID | 137221760 |
| Molecular Formula | C16H11N3NaO6S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)ccc23)cc1.[Na] |
| InChI | InChI=1S/C16H11N3O6S.Na/c20-15-8-1-10-9-13(26(23,24)25)6-7-14(10)16(15)18-17-11-2-4-12(5-3-11)19(21)22;/h1-9,20H,(H,23,24,25);/b18-17+; |
| InChIKey | WHFXNEJAVLLHKD-ZAGWXBKKSA-N |
| XLogP | 3.73 |
| TPSA | 142.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|