C16H12N2O7S2 — CID 16869
6-hydroxy-5-[(3-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 16869) has the molecular formula C16H12N2O7S2 and a molecular weight of 408.41 g/mol. Its IUPAC name is 6-hydroxy-5-[(3-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-hydroxy-5-[(3-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 16869 |
| Molecular Formula | C16H12N2O7S2 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 6-hydroxy-5-[(3-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)ccc23)c1 |
| InChI | InChI=1S/C16H12N2O7S2/c19-15-7-4-10-8-13(27(23,24)25)5-6-14(10)16(15)18-17-11-2-1-3-12(9-11)26(20,21)22/h1-9,19H,(H,20,21,22)(H,23,24,25)/b18-17+ |
| InChIKey | FDKBMCRSDXMDOJ-ISLYRVAYSA-N |
| XLogP | 3.45 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|