C34H26N4O8S2 — CID 136714884
6-hydroxy-5-[[4-[4-[(2-hydroxy-6-sulfonaphthalen-1-yl)diazenyl]-2-methylphenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136714884) has the molecular formula C34H26N4O8S2 and a molecular weight of 682.74 g/mol. Its IUPAC name is 6-hydroxy-5-[[4-[4-[(2-hydroxy-6-sulfonaphthalen-1-yl)diazenyl]-2-methylphenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-hydroxy-5-[[4-[4-[(2-hydroxy-6-sulfonaphthalen-1-yl)diazenyl]-2-methylphenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136714884 |
| Molecular Formula | C34H26N4O8S2 |
| Molecular Weight | 682.74 g/mol |
| Exact Mass | 682.12 |
| IUPAC Name | 6-hydroxy-5-[[4-[4-[(2-hydroxy-6-sulfonaphthalen-1-yl)diazenyl]-2-methylphenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)ccc23)ccc1-c1ccc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)ccc23)cc1C |
| InChI | InChI=1S/C34H26N4O8S2/c1-19-15-23(35-37-33-29-11-7-25(47(41,42)43)17-21(29)3-13-31(33)39)5-9-27(19)28-10-6-24(16-20(28)2)36-38-34-30-12-8-26(48(44,45)46)18-22(30)4-14-32(34)40/h3-18,39-40H,1-2H3,(H,41,42,43)(H,44,45,46)/b37-35+,38-36+ |
| InChIKey | ZNCROQIXQGXEMG-ATXIYDNESA-N |
| XLogP | 9.01 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.74 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|