C32H22N4Na2O8S3 — CID 137221884
CID 137221884 (PubChem CID 137221884) has the molecular formula C32H22N4Na2O8S3 and a molecular weight of 732.73 g/mol.
| Compound Name | CID 137221884 |
|---|---|
| PubChem CID | 137221884 |
| Molecular Formula | C32H22N4Na2O8S3 |
| Molecular Weight | 732.73 g/mol |
| Exact Mass | 732.04 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc2c(/N=N/c3ccc(Sc4ccc(/N=N/c5c(O)ccc6cc(S(=O)(=O)O)ccc56)cc4)cc3)c(O)ccc2c1.[Na].[Na] |
| InChI | InChI=1S/C32H22N4O8S3.2Na/c37-29-15-1-19-17-25(46(39,40)41)11-13-27(19)31(29)35-33-21-3-7-23(8-4-21)45-24-9-5-22(6-10-24)34-36-32-28-14-12-26(47(42,43)44)18-20(28)2-16-30(32)38;;/h1-18,37-38H,(H,39,40,41)(H,42,43,44);;/b35-33+,36-34+;; |
| InChIKey | KMYIXDATKBWUEV-UUIOKUIJSA-N |
| XLogP | 8.12 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.73 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|