C16H12BaN2O4S — CID 170843851
CID 170843851 (PubChem CID 170843851) has the molecular formula C16H12BaN2O4S and a molecular weight of 465.68 g/mol.
| Compound Name | CID 170843851 |
|---|---|
| PubChem CID | 170843851 |
| Molecular Formula | C16H12BaN2O4S |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.96 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc(/N=N/c2c(O)ccc3ccccc23)cc1.[Ba] |
| InChI | InChI=1S/C16H12N2O4S.Ba/c19-15-10-5-11-3-1-2-4-14(11)16(15)18-17-12-6-8-13(9-7-12)23(20,21)22;/h1-10,19H,(H,20,21,22);/b18-17+; |
| InChIKey | ZNTDIXNYFXNCSM-ZAGWXBKKSA-N |
| XLogP | 3.83 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|