C17H14N2O4S — CID 158079681
carbanylium;4-[(2-hydroxynaphthalen-1-yl)diazenyl]benzenesulfonate (PubChem CID 158079681) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is carbanylium;4-[(2-hydroxynaphthalen-1-yl)diazenyl]benzenesulfonate.
| Compound Name | carbanylium;4-[(2-hydroxynaphthalen-1-yl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 158079681 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | carbanylium;4-[(2-hydroxynaphthalen-1-yl)diazenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(/N=N/c2c(O)ccc3ccccc23)cc1.[CH3+] |
| InChI | InChI=1S/C16H12N2O4S.CH3/c19-15-10-5-11-3-1-2-4-14(11)16(15)18-17-12-6-8-13(9-7-12)23(20,21)22;/h1-10,19H,(H,20,21,22);1H3/q;+1/p-1/b18-17+; |
| InChIKey | FMUJWYLACRWUAZ-ZAGWXBKKSA-M |
| XLogP | 4.32 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|