C22H14N4Na2O7S2 — CID 20170
disodium;2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-[(4-sulfonatophenyl)diazenyl]benzenesulfonate (PubChem CID 20170) has the molecular formula C22H14N4Na2O7S2 and a molecular weight of 556.49 g/mol. Its IUPAC name is disodium;2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-[(4-sulfonatophenyl)diazenyl]benzenesulfonate.
| Compound Name | disodium;2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-[(4-sulfonatophenyl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 20170 |
| Molecular Formula | C22H14N4Na2O7S2 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | disodium;2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-[(4-sulfonatophenyl)diazenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(/N=N/c2ccc(/N=N/c3c(O)ccc4ccccc34)c(S(=O)(=O)[O-])c2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H16N4O7S2.2Na/c27-20-12-5-14-3-1-2-4-18(14)22(20)26-25-19-11-8-16(13-21(19)35(31,32)33)24-23-15-6-9-17(10-7-15)34(28,29)30;;/h1-13,27H,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2/b24-23+,26-25+;; |
| InChIKey | VVAVKBBTPWYADW-RVTJCSDESA-L |
| XLogP | -0.81 |
| TPSA | 184.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|