C16H10N3NaO7S — CID 136784995
sodium 2-hydroxy-3-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-nitrobenzenesulfonate (PubChem CID 136784995) has the molecular formula C16H10N3NaO7S and a molecular weight of 411.33 g/mol. Its IUPAC name is sodium 2-hydroxy-3-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-nitrobenzenesulfonate.
| Compound Name | sodium 2-hydroxy-3-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 136784995 |
| Molecular Formula | C16H10N3NaO7S |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | sodium 2-hydroxy-3-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cc(/N=N/c2c(O)ccc3ccccc23)c(O)c(S(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C16H11N3O7S.Na/c20-13-6-5-9-3-1-2-4-11(9)15(13)18-17-12-7-10(19(22)23)8-14(16(12)21)27(24,25)26;/h1-8,20-21H,(H,24,25,26);/q;+1/p-1/b18-17+; |
| InChIKey | RKSPVXPJJQJMPL-ZAGWXBKKSA-M |
| XLogP | 0.48 |
| TPSA | 165.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|