C32H22FeN6O8 — CID 167455353
1-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-2-ol;1-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalen-2-ol;iron (PubChem CID 167455353) has the molecular formula C32H22FeN6O8 and a molecular weight of 674.41 g/mol. Its IUPAC name is 1-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-2-ol;1-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalen-2-ol;iron.
| Compound Name | 1-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-2-ol;1-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalen-2-ol;iron |
|---|---|
| PubChem CID | 167455353 |
| Molecular Formula | C32H22FeN6O8 |
| Molecular Weight | 674.41 g/mol |
| Exact Mass | 674.08 |
| IUPAC Name | 1-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-2-ol;1-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalen-2-ol;iron |
| SMILES | O=[N+]([O-])c1ccc(/N=N\c2c(O)ccc3ccccc23)c(O)c1.O=[N+]([O-])c1ccc(O)c(/N=N\c2c(O)ccc3ccccc23)c1.[Fe] |
| InChI | InChI=1S/2C16H11N3O4.Fe/c20-14-8-5-10-3-1-2-4-12(10)16(14)18-17-13-7-6-11(19(22)23)9-15(13)21;20-14-8-6-11(19(22)23)9-13(14)17-18-16-12-4-2-1-3-10(12)5-7-15(16)21;/h2*1-9,20-21H;/b2*18-17-; |
| InChIKey | VHWSIURYJWJRDN-PTZSQULPSA-N |
| XLogP | 9.15 |
| TPSA | 216.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.41 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|