C32H19CrN6O11S — CID 170852043
chromium(3+);1-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-2-ol;5-nitro-2-oxido-3-[(2-oxidonaphthalen-1-yl)diazenyl]benzenesulfonate (PubChem CID 170852043) has the molecular formula C32H19CrN6O11S and a molecular weight of 747.60 g/mol. Its IUPAC name is chromium(3+);1-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-2-ol;5-nitro-2-oxido-3-[(2-oxidonaphthalen-1-yl)diazenyl]benzenesulfonate.
| Compound Name | chromium(3+);1-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-2-ol;5-nitro-2-oxido-3-[(2-oxidonaphthalen-1-yl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 170852043 |
| Molecular Formula | C32H19CrN6O11S |
| Molecular Weight | 747.60 g/mol |
| Exact Mass | 747.02 |
| IUPAC Name | chromium(3+);1-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-2-ol;5-nitro-2-oxido-3-[(2-oxidonaphthalen-1-yl)diazenyl]benzenesulfonate |
| SMILES | O=[N+]([O-])c1cc(/N=N/c2c([O-])ccc3ccccc23)c([O-])c(S(=O)(=O)[O-])c1.O=[N+]([O-])c1ccc(/N=N/c2c(O)ccc3ccccc23)c(O)c1.[Cr+3] |
| InChI | InChI=1S/C16H11N3O7S.C16H11N3O4.Cr/c20-13-6-5-9-3-1-2-4-11(9)15(13)18-17-12-7-10(19(22)23)8-14(16(12)21)27(24,25)26;20-14-8-5-10-3-1-2-4-12(10)16(14)18-17-13-7-6-11(19(22)23)9-15(13)21;/h1-8,20-21H,(H,24,25,26);1-9,20-21H;/q;;+3/p-3/b2*18-17+; |
| InChIKey | SLWDDJVIDZKDQJ-IVYOCVIQSA-K |
| XLogP | 6.79 |
| TPSA | 279.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|