C20H12CrN3O8S — CID 170853738
chromium(3+);7-nitro-3-oxido-4-[(2-oxidonaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate;hydrate (PubChem CID 170853738) has the molecular formula C20H12CrN3O8S and a molecular weight of 506.39 g/mol. Its IUPAC name is chromium(3+);7-nitro-3-oxido-4-[(2-oxidonaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate;hydrate.
| Compound Name | chromium(3+);7-nitro-3-oxido-4-[(2-oxidonaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate;hydrate |
|---|---|
| PubChem CID | 170853738 |
| Molecular Formula | C20H12CrN3O8S |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | chromium(3+);7-nitro-3-oxido-4-[(2-oxidonaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate;hydrate |
| SMILES | O.O=[N+]([O-])c1ccc2c(/N=N/c3c([O-])ccc4ccccc34)c([O-])cc(S(=O)(=O)[O-])c2c1.[Cr+3] |
| InChI | InChI=1S/C20H13N3O7S.Cr.H2O/c24-16-8-5-11-3-1-2-4-13(11)19(16)21-22-20-14-7-6-12(23(26)27)9-15(14)18(10-17(20)25)31(28,29)30;;/h1-10,24-25H,(H,28,29,30);;1H2/q;+3;/p-3/b22-21+;; |
| InChIKey | OZERAQPZLAPVPE-ZPZFBZIMSA-K |
| XLogP | 2.54 |
| TPSA | 202.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|