C21H13N3O5 — CID 139556597
3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)diazenyl]-7-nitronaphthalene-1-carbaldehyde (PubChem CID 139556597) has the molecular formula C21H13N3O5 and a molecular weight of 387.35 g/mol. Its IUPAC name is 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)diazenyl]-7-nitronaphthalene-1-carbaldehyde.
| Compound Name | 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)diazenyl]-7-nitronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 139556597 |
| Molecular Formula | C21H13N3O5 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)diazenyl]-7-nitronaphthalene-1-carbaldehyde |
| SMILES | O=Cc1cc(O)c(/N=N/c2c(O)ccc3ccccc23)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H13N3O5/c25-11-13-9-19(27)21(16-7-6-14(24(28)29)10-17(13)16)23-22-20-15-4-2-1-3-12(15)5-8-18(20)26/h1-11,26-27H/b23-22+ |
| InChIKey | GVUOTVYUYDJHIM-GHVJWSGMSA-N |
| XLogP | 5.54 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|