C23H19N3O2 — CID 118100515
(2,4-dimethyl-6-nitronaphthalen-1-yl)-(2-methylnaphthalen-1-yl)diazene (PubChem CID 118100515) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is (2,4-dimethyl-6-nitronaphthalen-1-yl)-(2-methylnaphthalen-1-yl)diazene.
| Compound Name | (2,4-dimethyl-6-nitronaphthalen-1-yl)-(2-methylnaphthalen-1-yl)diazene |
|---|---|
| PubChem CID | 118100515 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (2,4-dimethyl-6-nitronaphthalen-1-yl)-(2-methylnaphthalen-1-yl)diazene |
| SMILES | Cc1ccc2ccccc2c1/N=N/c1c(C)cc(C)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C23H19N3O2/c1-14-8-9-17-6-4-5-7-19(17)22(14)24-25-23-16(3)12-15(2)21-13-18(26(27)28)10-11-20(21)23/h4-13H,1-3H3/b25-24+ |
| InChIKey | LUQBRUCEMQDEGY-OCOZRVBESA-N |
| XLogP | 7.24 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|