About 1-methyl-4-nitrobenzene;3-methylphenanthrene
1-methyl-4-nitrobenzene;3-methylphenanthrene (PubChem CID 91179240) has the molecular formula C22H19NO2
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-methyl-4-nitrobenzene;3-methylphenanthrene.
Molecular Properties
| Compound Name | 1-methyl-4-nitrobenzene;3-methylphenanthrene |
| PubChem CID | 91179240 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-methyl-4-nitrobenzene;3-methylphenanthrene |
| SMILES | Cc1ccc([N+](=O)[O-])cc1.Cc1ccc2ccc3ccccc3c2c1 |
| InChI | InChI=1S/C15H12.C7H7NO2/c1-11-6-7-13-9-8-12-4-2-3-5-14(12)15(13)10-11;1-6-2-4-7(5-3-6)8(9)10/h2-10H,1H3;2-5H,1H3 |
| InChIKey | XBHSPSTZYGVWCB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-nitrobenzene;3-methylphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-nitrobenzene;3-methylphenanthrene?
The IUPAC name of 1-methyl-4-nitrobenzene;3-methylphenanthrene (CID 91179240) is 1-methyl-4-nitrobenzene;3-methylphenanthrene.
What is the SMILES notation for 1-methyl-4-nitrobenzene;3-methylphenanthrene?
The canonical SMILES for 1-methyl-4-nitrobenzene;3-methylphenanthrene is Cc1ccc([N+](=O)[O-])cc1.Cc1ccc2ccc3ccccc3c2c1.
What is the InChIKey of 1-methyl-4-nitrobenzene;3-methylphenanthrene?
The InChIKey is XBHSPSTZYGVWCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C7H7NO2/c1-11-6-7-13-9-8-12-4-2-3-5-14(12)15(13)10-11;1-6-2-4-7(5-3-6)8(9)10/h2-10H,1H3;2-5H,1H3.
What are the key properties of 1-methyl-4-nitrobenzene;3-methylphenanthrene?
1-methyl-4-nitrobenzene;3-methylphenanthrene has a molecular weight of 329.40 g/mol, XLogP of 6.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-nitrobenzene;3-methylphenanthrene is sourced from PubChem (CID 91179240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).