C32H19CoN6O8 — CID 170842552
cobalt(3+);2-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-1-olate;2-[(4-nitro-2-oxidophenyl)diazenyl]naphthalen-1-olate (PubChem CID 170842552) has the molecular formula C32H19CoN6O8 and a molecular weight of 674.47 g/mol. Its IUPAC name is cobalt(3+);2-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-1-olate;2-[(4-nitro-2-oxidophenyl)diazenyl]naphthalen-1-olate.
| Compound Name | cobalt(3+);2-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-1-olate;2-[(4-nitro-2-oxidophenyl)diazenyl]naphthalen-1-olate |
|---|---|
| PubChem CID | 170842552 |
| Molecular Formula | C32H19CoN6O8 |
| Molecular Weight | 674.47 g/mol |
| Exact Mass | 674.06 |
| IUPAC Name | cobalt(3+);2-[(2-hydroxy-4-nitrophenyl)diazenyl]naphthalen-1-olate;2-[(4-nitro-2-oxidophenyl)diazenyl]naphthalen-1-olate |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc3ccccc3c2[O-])c([O-])c1.O=[N+]([O-])c1ccc(/N=N\c2ccc3ccccc3c2[O-])c(O)c1.[Co+3] |
| InChI | InChI=1S/2C16H11N3O4.Co/c2*20-15-9-11(19(22)23)6-8-13(15)17-18-14-7-5-10-3-1-2-4-12(10)16(14)21;/h2*1-9,20-21H;/q;;+3/p-3/b18-17+;18-17-; |
| InChIKey | QOUPJTRZOOSQQZ-UXJVHJBYSA-K |
| XLogP | 7.25 |
| TPSA | 225.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.47 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|