C20H12N2Na2O7S2 — CID 3034835
disodium;2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1,5-disulfonate (PubChem CID 3034835) has the molecular formula C20H12N2Na2O7S2 and a molecular weight of 502.44 g/mol. Its IUPAC name is disodium;2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1,5-disulfonate.
| Compound Name | disodium;2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1,5-disulfonate |
|---|---|
| PubChem CID | 3034835 |
| Molecular Formula | C20H12N2Na2O7S2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | disodium;2-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1,5-disulfonate |
| SMILES | O=S(=O)([O-])c1cccc2c(S(=O)(=O)[O-])c(/N=N/c3c(O)ccc4ccccc34)ccc12.[Na+].[Na+] |
| InChI | InChI=1S/C20H14N2O7S2.2Na/c23-17-11-8-12-4-1-2-5-13(12)19(17)22-21-16-10-9-14-15(20(16)31(27,28)29)6-3-7-18(14)30(24,25)26;;/h1-11,23H,(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2/b22-21+;; |
| InChIKey | AZMFCRZJELRHQH-ZPZFBZIMSA-L |
| XLogP | -2.07 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|