C20H13N2NaO4S — CID 135488958
sodium 5-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate (PubChem CID 135488958) has the molecular formula C20H13N2NaO4S and a molecular weight of 400.39 g/mol. Its IUPAC name is sodium 5-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | sodium 5-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135488958 |
| Molecular Formula | C20H13N2NaO4S |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | sodium 5-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(/N=N/c3c(O)ccc4ccccc34)cccc2c1.[Na+] |
| InChI | InChI=1S/C20H14N2O4S.Na/c23-19-11-8-13-4-1-2-6-17(13)20(19)22-21-18-7-3-5-14-12-15(27(24,25)26)9-10-16(14)18;/h1-12,23H,(H,24,25,26);/q;+1/p-1/b22-21+; |
| InChIKey | ZQZDZGKEAGXSSW-QUABFQRHSA-M |
| XLogP | 2.02 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|