C16H11ClN2NaO4S — CID 137235039
CID 137235039 (PubChem CID 137235039) has the molecular formula C16H11ClN2NaO4S and a molecular weight of 385.78 g/mol.
| Compound Name | CID 137235039 |
|---|---|
| PubChem CID | 137235039 |
| Molecular Formula | C16H11ClN2NaO4S |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc2c(/N=N/c3ccccc3Cl)c(O)ccc2c1.[Na] |
| InChI | InChI=1S/C16H11ClN2O4S.Na/c17-13-3-1-2-4-14(13)18-19-16-12-7-6-11(24(21,22)23)9-10(12)5-8-15(16)20;/h1-9,20H,(H,21,22,23);/b19-18+; |
| InChIKey | RCUQPDWKJAFIRO-LTRPLHCISA-N |
| XLogP | 4.48 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|