C18H15ClN2O7S2 — CID 135565739
5-[(4-chloro-5-ethyl-2-sulfophenyl)diazenyl]-6-hydroxynaphthalene-2-sulfonic acid (PubChem CID 135565739) has the molecular formula C18H15ClN2O7S2 and a molecular weight of 470.91 g/mol. Its IUPAC name is 5-[(4-chloro-5-ethyl-2-sulfophenyl)diazenyl]-6-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 5-[(4-chloro-5-ethyl-2-sulfophenyl)diazenyl]-6-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135565739 |
| Molecular Formula | C18H15ClN2O7S2 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 5-[(4-chloro-5-ethyl-2-sulfophenyl)diazenyl]-6-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CCc1cc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)ccc23)c(S(=O)(=O)O)cc1Cl |
| InChI | InChI=1S/C18H15ClN2O7S2/c1-2-10-8-15(17(9-14(10)19)30(26,27)28)20-21-18-13-5-4-12(29(23,24)25)7-11(13)3-6-16(18)22/h3-9,22H,2H2,1H3,(H,23,24,25)(H,26,27,28)/b21-20+ |
| InChIKey | BTHAHRKSJDKOHV-QZQOTICOSA-N |
| XLogP | 4.67 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|