C34H26Cl2N4O8S2Sr+2 — CID 137216273
strontium bis(5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonic acid) (PubChem CID 137216273) has the molecular formula C34H26Cl2N4O8S2Sr+2 and a molecular weight of 841.26 g/mol. Its IUPAC name is strontium bis(5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonic acid).
| Compound Name | strontium bis(5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 137216273 |
| Molecular Formula | C34H26Cl2N4O8S2Sr+2 |
| Molecular Weight | 841.26 g/mol |
| Exact Mass | 839.96 |
| IUPAC Name | strontium bis(5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonic acid) |
| SMILES | Cc1cc(/N=N/c2c(O)ccc3ccccc23)c(S(=O)(=O)O)cc1Cl.Cc1cc(/N=N/c2c(O)ccc3ccccc23)c(S(=O)(=O)O)cc1Cl.[Sr+2] |
| InChI | InChI=1S/2C17H13ClN2O4S.Sr/c2*1-10-8-14(16(9-13(10)18)25(22,23)24)19-20-17-12-5-3-2-4-11(12)6-7-15(17)21;/h2*2-9,21H,1H3,(H,22,23,24);/q;;+2/b2*20-19+; |
| InChIKey | GIWRCSUZRBTMDC-FFRZOONGSA-N |
| XLogP | 9.96 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.26 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|