C34H26BaCl2N4O8S2+2 — CID 165415560
barium(2+);bis(4-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-methylbenzenesulfonic acid) (PubChem CID 165415560) has the molecular formula C34H26BaCl2N4O8S2+2 and a molecular weight of 890.97 g/mol. Its IUPAC name is barium(2+);bis(4-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-methylbenzenesulfonic acid).
| Compound Name | barium(2+);bis(4-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 165415560 |
| Molecular Formula | C34H26BaCl2N4O8S2+2 |
| Molecular Weight | 890.97 g/mol |
| Exact Mass | 889.96 |
| IUPAC Name | barium(2+);bis(4-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-methylbenzenesulfonic acid) |
| SMILES | Cc1cc(S(=O)(=O)O)c(/N=N/c2c(O)ccc3ccccc23)cc1Cl.Cc1cc(S(=O)(=O)O)c(/N=N/c2c(O)ccc3ccccc23)cc1Cl.[Ba+2] |
| InChI | InChI=1S/2C17H13ClN2O4S.Ba/c2*1-10-8-16(25(22,23)24)14(9-13(10)18)19-20-17-12-5-3-2-4-11(12)6-7-15(17)21;/h2*2-9,21H,1H3,(H,22,23,24);/q;;+2/b2*20-19+; |
| InChIKey | OTLKEWOVEAZDMR-FFRZOONGSA-N |
| XLogP | 9.96 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.97 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|