C23H17ClN4O5S — CID 170843268
2-chloro-5-[[4-hydroxy-5-[(2-hydroxynaphthalen-1-yl)diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid (PubChem CID 170843268) has the molecular formula C23H17ClN4O5S and a molecular weight of 496.93 g/mol. Its IUPAC name is 2-chloro-5-[[4-hydroxy-5-[(2-hydroxynaphthalen-1-yl)diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-chloro-5-[[4-hydroxy-5-[(2-hydroxynaphthalen-1-yl)diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 170843268 |
| Molecular Formula | C23H17ClN4O5S |
| Molecular Weight | 496.93 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2-chloro-5-[[4-hydroxy-5-[(2-hydroxynaphthalen-1-yl)diazenyl]-2-methylphenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc(O)c(/N=N/c2c(O)ccc3ccccc23)cc1/N=N/c1ccc(Cl)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C23H17ClN4O5S/c1-13-10-21(30)19(27-28-23-16-5-3-2-4-14(16)6-9-20(23)29)12-18(13)26-25-15-7-8-17(24)22(11-15)34(31,32)33/h2-12,29-30H,1H3,(H,31,32,33)/b26-25+,28-27+ |
| InChIKey | UMNBCWGQIXILTH-PAMTUDGESA-N |
| XLogP | 7.29 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.93 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|