C18H14N3NaO6S — CID 136736072
sodium N-[4-hydroxy-3-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-sulfophenyl]ethanimidate (PubChem CID 136736072) has the molecular formula C18H14N3NaO6S and a molecular weight of 423.38 g/mol. Its IUPAC name is sodium N-[4-hydroxy-3-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-sulfophenyl]ethanimidate.
| Compound Name | sodium N-[4-hydroxy-3-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-sulfophenyl]ethanimidate |
|---|---|
| PubChem CID | 136736072 |
| Molecular Formula | C18H14N3NaO6S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | sodium N-[4-hydroxy-3-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-sulfophenyl]ethanimidate |
| SMILES | C/C([O-])=N\c1cc(/N=N/c2c(O)ccc3ccccc23)c(O)c(S(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C18H15N3O6S.Na/c1-10(22)19-12-8-14(18(24)16(9-12)28(25,26)27)20-21-17-13-5-3-2-4-11(13)6-7-15(17)23;/h2-9,23-24H,1H3,(H,19,22)(H,25,26,27);/q;+1/p-1/b21-20+; |
| InChIKey | XENUHPPCUDWMBS-ANVLNOONSA-M |
| XLogP | 0.33 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|