C17H13N2NaO5S — CID 170846181
sodium 2-[(2-hydroxynaphthalen-1-yl)diazenyl]-6-methyl-4-sulfophenolate (PubChem CID 170846181) has the molecular formula C17H13N2NaO5S and a molecular weight of 380.36 g/mol. Its IUPAC name is sodium 2-[(2-hydroxynaphthalen-1-yl)diazenyl]-6-methyl-4-sulfophenolate.
| Compound Name | sodium 2-[(2-hydroxynaphthalen-1-yl)diazenyl]-6-methyl-4-sulfophenolate |
|---|---|
| PubChem CID | 170846181 |
| Molecular Formula | C17H13N2NaO5S |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | sodium 2-[(2-hydroxynaphthalen-1-yl)diazenyl]-6-methyl-4-sulfophenolate |
| SMILES | Cc1cc(S(=O)(=O)O)cc(/N=N/c2c(O)ccc3ccccc23)c1[O-].[Na+] |
| InChI | InChI=1S/C17H14N2O5S.Na/c1-10-8-12(25(22,23)24)9-14(17(10)21)18-19-16-13-5-3-2-4-11(13)6-7-15(16)20;/h2-9,20-21H,1H3,(H,22,23,24);/q;+1/p-1/b19-18+; |
| InChIKey | SZNNAHNKEBYFNP-LTRPLHCISA-M |
| XLogP | 0.59 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|