C18H16N2NaO4S+ — CID 135422001
sodium 5-[(2,4-dimethylphenyl)diazenyl]-6-hydroxynaphthalene-2-sulfonic acid (PubChem CID 135422001) has the molecular formula C18H16N2NaO4S+ and a molecular weight of 379.39 g/mol. Its IUPAC name is sodium 5-[(2,4-dimethylphenyl)diazenyl]-6-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | sodium 5-[(2,4-dimethylphenyl)diazenyl]-6-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135422001 |
| Molecular Formula | C18H16N2NaO4S+ |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | sodium 5-[(2,4-dimethylphenyl)diazenyl]-6-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)ccc23)c(C)c1.[Na+] |
| InChI | InChI=1S/C18H16N2O4S.Na/c1-11-3-7-16(12(2)9-11)19-20-18-15-6-5-14(25(22,23)24)10-13(15)4-8-17(18)21;/h3-10,21H,1-2H3,(H,22,23,24);/q;+1/b20-19+; |
| InChIKey | ZCJBGUAIONCVNG-RZLHGTIFSA-N |
| XLogP | 1.83 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|