C24H22N4O3S — CID 10478742
6-amino-5-[[4-(4-amino-3-methylphenyl)-2-methylphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 10478742) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 6-amino-5-[[4-(4-amino-3-methylphenyl)-2-methylphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-amino-5-[[4-(4-amino-3-methylphenyl)-2-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 10478742 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 6-amino-5-[[4-(4-amino-3-methylphenyl)-2-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(-c2ccc(/N=N/c3c(N)ccc4cc(S(=O)(=O)O)ccc34)c(C)c2)ccc1N |
| InChI | InChI=1S/C24H22N4O3S/c1-14-11-16(3-8-21(14)25)17-5-10-23(15(2)12-17)27-28-24-20-7-6-19(32(29,30)31)13-18(20)4-9-22(24)26/h3-13H,25-26H2,1-2H3,(H,29,30,31)/b28-27+ |
| InChIKey | IEXFURZHBZWVGA-BYYHNAKLSA-N |
| XLogP | 5.95 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|