C24H20N4O7S2 — CID 2748965
5-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methyl-2-[(2-methyl-5-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 2748965) has the molecular formula C24H20N4O7S2 and a molecular weight of 540.58 g/mol. Its IUPAC name is 5-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methyl-2-[(2-methyl-5-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 5-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methyl-2-[(2-methyl-5-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 2748965 |
| Molecular Formula | C24H20N4O7S2 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 5-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methyl-2-[(2-methyl-5-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1/N=N/c1cc(C)c(/N=N/c2c(O)ccc3ccccc23)cc1S(=O)(=O)O |
| InChI | InChI=1S/C24H20N4O7S2/c1-14-7-9-17(36(30,31)32)12-19(14)25-27-21-11-15(2)20(13-23(21)37(33,34)35)26-28-24-18-6-4-3-5-16(18)8-10-22(24)29/h3-13,29H,1-2H3,(H,30,31,32)(H,33,34,35)/b27-25+,28-26+ |
| InChIKey | YJFPEQCGBKUNPP-NBHCHVEOSA-N |
| XLogP | 6.49 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|