C34H24Cl2N4O8S2-2 — CID 139595511
5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate (PubChem CID 139595511) has the molecular formula C34H24Cl2N4O8S2-2 and a molecular weight of 751.63 g/mol. Its IUPAC name is 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate.
| Compound Name | 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139595511 |
| Molecular Formula | C34H24Cl2N4O8S2-2 |
| Molecular Weight | 751.63 g/mol |
| Exact Mass | 750.04 |
| IUPAC Name | 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate |
| SMILES | Cc1cc(/N=N/c2c(O)ccc3ccccc23)c(S(=O)(=O)[O-])cc1Cl.Cc1cc(/N=N/c2c(O)ccc3ccccc23)c(S(=O)(=O)[O-])cc1Cl |
| InChI | InChI=1S/2C17H13ClN2O4S/c2*1-10-8-14(16(9-13(10)18)25(22,23)24)19-20-17-12-5-3-2-4-11(12)6-7-15(17)21/h2*2-9,21H,1H3,(H,22,23,24)/p-2/b2*20-19+ |
| InChIKey | YAVRYOFZKIKWIL-HQNBDFGLSA-L |
| XLogP | 9.65 |
| TPSA | 204.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.63 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|