C17H12ClN2NaO4S — CID 102269573
sodium 1-[(4-chloro-5-methyl-2-sulfophenyl)diazenyl]naphthalen-2-olate (PubChem CID 102269573) has the molecular formula C17H12ClN2NaO4S and a molecular weight of 398.80 g/mol. Its IUPAC name is sodium 1-[(4-chloro-5-methyl-2-sulfophenyl)diazenyl]naphthalen-2-olate.
| Compound Name | sodium 1-[(4-chloro-5-methyl-2-sulfophenyl)diazenyl]naphthalen-2-olate |
|---|---|
| PubChem CID | 102269573 |
| Molecular Formula | C17H12ClN2NaO4S |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | sodium 1-[(4-chloro-5-methyl-2-sulfophenyl)diazenyl]naphthalen-2-olate |
| SMILES | Cc1cc(/N=N/c2c([O-])ccc3ccccc23)c(S(=O)(=O)O)cc1Cl.[Na+] |
| InChI | InChI=1S/C17H13ClN2O4S.Na/c1-10-8-14(16(9-13(10)18)25(22,23)24)19-20-17-12-5-3-2-4-11(12)6-7-15(17)21;/h2-9,21H,1H3,(H,22,23,24);/q;+1/p-1/b20-19+; |
| InChIKey | LLELVHKMCSBMCX-RZLHGTIFSA-M |
| XLogP | 1.54 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|