C18H11ClN2O6SSr-2 — CID 135853525
CID 135853525 (PubChem CID 135853525) has the molecular formula C18H11ClN2O6SSr-2 and a molecular weight of 506.43 g/mol.
| Compound Name | CID 135853525 |
|---|---|
| PubChem CID | 135853525 |
| Molecular Formula | C18H11ClN2O6SSr-2 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.91 |
| IUPAC Name | — |
| SMILES | Cc1cc(/N=N/c2c([O-])c(C(=O)O)cc3ccccc23)c(S(=O)(=O)[O-])cc1Cl.[Sr] |
| InChI | InChI=1S/C18H13ClN2O6S.Sr/c1-9-6-14(15(8-13(9)19)28(25,26)27)20-21-16-11-5-3-2-4-10(11)7-12(17(16)22)18(23)24;/h2-8,22H,1H3,(H,23,24)(H,25,26,27);/p-2/b21-20+; |
| InChIKey | YDHVXVHNVWJJNR-ANVLNOONSA-L |
| XLogP | 3.51 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|