C19H13ClN2O6SSr — CID 135666449
strontium 2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-5-chloro-4-ethylbenzenesulfonate (PubChem CID 135666449) has the molecular formula C19H13ClN2O6SSr and a molecular weight of 520.46 g/mol. Its IUPAC name is strontium 2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-5-chloro-4-ethylbenzenesulfonate.
| Compound Name | strontium 2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-5-chloro-4-ethylbenzenesulfonate |
|---|---|
| PubChem CID | 135666449 |
| Molecular Formula | C19H13ClN2O6SSr |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.92 |
| IUPAC Name | strontium 2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-5-chloro-4-ethylbenzenesulfonate |
| SMILES | CCc1cc(/N=N/c2c([O-])c(C(=O)O)cc3ccccc23)c(S(=O)(=O)[O-])cc1Cl.[Sr+2] |
| InChI | InChI=1S/C19H15ClN2O6S.Sr/c1-2-10-8-15(16(9-14(10)20)29(26,27)28)21-22-17-12-6-4-3-5-11(12)7-13(18(17)23)19(24)25;/h3-9,23H,2H2,1H3,(H,24,25)(H,26,27,28);/q;+2/p-2/b22-21+; |
| InChIKey | WMPTVIKQGYCBFP-QUABFQRHSA-L |
| XLogP | 3.77 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|