C34H22CuN4O6 — CID 175731451
copper bis(3-carboxy-1-phenyldiazenylnaphthalen-2-olate) (PubChem CID 175731451) has the molecular formula C34H22CuN4O6 and a molecular weight of 646.12 g/mol. Its IUPAC name is copper bis(3-carboxy-1-phenyldiazenylnaphthalen-2-olate).
| Compound Name | copper bis(3-carboxy-1-phenyldiazenylnaphthalen-2-olate) |
|---|---|
| PubChem CID | 175731451 |
| Molecular Formula | C34H22CuN4O6 |
| Molecular Weight | 646.12 g/mol |
| Exact Mass | 645.08 |
| IUPAC Name | copper bis(3-carboxy-1-phenyldiazenylnaphthalen-2-olate) |
| SMILES | O=C(O)c1cc2ccccc2c(/N=N/c2ccccc2)c1[O-].O=C(O)c1cc2ccccc2c(/N=N/c2ccccc2)c1[O-].[Cu+2] |
| InChI | InChI=1S/2C17H12N2O3.Cu/c2*20-16-14(17(21)22)10-11-6-4-5-9-13(11)15(16)19-18-12-7-2-1-3-8-12;/h2*1-10,20H,(H,21,22);/q;;+2/p-2/b2*19-18+; |
| InChIKey | OPZGSCYAVKVXQO-VFUQPONKSA-L |
| XLogP | 8.05 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.12 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|