C23H14Cs2O6 — CID 54702486
dicesium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate (PubChem CID 54702486) has the molecular formula C23H14Cs2O6 and a molecular weight of 652.17 g/mol. Its IUPAC name is dicesium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate.
| Compound Name | dicesium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate |
|---|---|
| PubChem CID | 54702486 |
| Molecular Formula | C23H14Cs2O6 |
| Molecular Weight | 652.17 g/mol |
| Exact Mass | 651.89 |
| IUPAC Name | dicesium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate |
| SMILES | O=C(O)c1cc2ccccc2c(Cc2c([O-])c(C(=O)O)cc3ccccc23)c1[O-].[Cs+].[Cs+] |
| InChI | InChI=1S/C23H16O6.2Cs/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;;/h1-10,24-25H,11H2,(H,26,27)(H,28,29);;/q;2*+1/p-2 |
| InChIKey | CYDFAMLPBMJQMJ-UHFFFAOYSA-L |
| XLogP | -2.86 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.17 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |