C25H18O10 — CID 69083270
4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid;oxalic acid (PubChem CID 69083270) has the molecular formula C25H18O10 and a molecular weight of 478.41 g/mol. Its IUPAC name is 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid;oxalic acid.
| Compound Name | 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid;oxalic acid |
|---|---|
| PubChem CID | 69083270 |
| Molecular Formula | C25H18O10 |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| InChI | InChI=1S/C23H16O6.C2H2O4/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;3-1(4)2(5)6/h1-10,24-25H,11H2,(H,26,27)(H,28,29);(H,3,4)(H,5,6) |
| InChIKey | HCHNCMOVASNGNG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|