C27H25NO5 — CID 102510581
4-[[3-(butylcarbamoyl)-2-hydroxynaphthalen-1-yl]methyl]-3-hydroxynaphthalene-2-carboxylic acid (PubChem CID 102510581) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-[[3-(butylcarbamoyl)-2-hydroxynaphthalen-1-yl]methyl]-3-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | 4-[[3-(butylcarbamoyl)-2-hydroxynaphthalen-1-yl]methyl]-3-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 102510581 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 4-[[3-(butylcarbamoyl)-2-hydroxynaphthalen-1-yl]methyl]-3-hydroxynaphthalene-2-carboxylic acid |
| SMILES | CCCCNC(=O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| InChI | InChI=1S/C27H25NO5/c1-2-3-12-28-26(31)22-13-16-8-4-6-10-18(16)20(24(22)29)15-21-19-11-7-5-9-17(19)14-23(25(21)30)27(32)33/h4-11,13-14,29-30H,2-3,12,15H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | GEODZDZPEWXSSZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|