C22H14O6Zn2+4 — CID 161380259
dizinc;4-(3-carboxy-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylic acid (PubChem CID 161380259) has the molecular formula C22H14O6Zn2+4 and a molecular weight of 505.13 g/mol. Its IUPAC name is dizinc;4-(3-carboxy-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | dizinc;4-(3-carboxy-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 161380259 |
| Molecular Formula | C22H14O6Zn2+4 |
| Molecular Weight | 505.13 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | dizinc;4-(3-carboxy-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2c(-c2c(O)c(C(=O)O)cc3ccccc23)c1O.[Zn+2].[Zn+2] |
| InChI | InChI=1S/C22H14O6.2Zn/c23-19-15(21(25)26)9-11-5-1-3-7-13(11)17(19)18-14-8-4-2-6-12(14)10-16(20(18)24)22(27)28;;/h1-10,23-24H,(H,25,26)(H,27,28);;/q;2*+2 |
| InChIKey | VRPXNJXLNAEOKN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.13 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|