C12H10O3 — CID 58932971
4-hydroxy-3-methylnaphthalene-2-carboxylic acid (PubChem CID 58932971) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 4-hydroxy-3-methylnaphthalene-2-carboxylic acid.
| Compound Name | 4-hydroxy-3-methylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 58932971 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 4-hydroxy-3-methylnaphthalene-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cc2ccccc2c1O |
| InChI | InChI=1S/C12H10O3/c1-7-10(12(14)15)6-8-4-2-3-5-9(8)11(7)13/h2-6,13H,1H3,(H,14,15) |
| InChIKey | JFAZWJRLFLHLQP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |