C25H26O4 — CID 160574931
ethane;3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalene-2-carboxylic acid (PubChem CID 160574931) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is ethane;3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalene-2-carboxylic acid.
| Compound Name | ethane;3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 160574931 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | ethane;3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalene-2-carboxylic acid |
| SMILES | CC.CC.O=C(O)c1cc2ccccc2c(-c2c(O)ccc3ccccc23)c1O |
| InChI | InChI=1S/C21H14O4.2C2H6/c22-17-10-9-12-5-1-3-7-14(12)18(17)19-15-8-4-2-6-13(15)11-16(20(19)23)21(24)25;2*1-2/h1-11,22-23H,(H,24,25);2*1-2H3 |
| InChIKey | RBADUNFZZRNUSW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |