C22H17NO3 — CID 101061990
3-hydroxy-4-(2-hydroxynaphthalen-1-yl)-N-methylnaphthalene-2-carboxamide (PubChem CID 101061990) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-hydroxy-4-(2-hydroxynaphthalen-1-yl)-N-methylnaphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-4-(2-hydroxynaphthalen-1-yl)-N-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 101061990 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-hydroxy-4-(2-hydroxynaphthalen-1-yl)-N-methylnaphthalene-2-carboxamide |
| SMILES | CNC(=O)c1cc2ccccc2c(-c2c(O)ccc3ccccc23)c1O |
| InChI | InChI=1S/C22H17NO3/c1-23-22(26)17-12-14-7-3-5-9-16(14)20(21(17)25)19-15-8-4-2-6-13(15)10-11-18(19)24/h2-12,24-25H,1H3,(H,23,26) |
| InChIKey | MPFDERNSEPUBNY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |