C22H17NO3 — CID 10427547
methyl 4-(2-aminonaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylate (PubChem CID 10427547) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 4-(2-aminonaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylate.
| Compound Name | methyl 4-(2-aminonaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 10427547 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | methyl 4-(2-aminonaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2c(-c2c(N)ccc3ccccc23)c1O |
| InChI | InChI=1S/C22H17NO3/c1-26-22(25)17-12-14-7-3-5-9-16(14)20(21(17)24)19-15-8-4-2-6-13(15)10-11-18(19)23/h2-12,24H,23H2,1H3 |
| InChIKey | YFCNIWVKAKQJJX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|